C12H15ClO3 — CID 83843382
2-(5-chloro-2-methoxyphenyl)-2-methylbutanoic acid (PubChem CID 83843382) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-2-methylbutanoic acid.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 83843382 |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-2-methylbutanoic acid |
| SMILES | CCC(C)(C(=O)O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C12H15ClO3/c1-4-12(2,11(14)15)9-7-8(13)5-6-10(9)16-3/h5-7H,4H2,1-3H3,(H,14,15) |
| InChIKey | DDIFRQGIBSKHDS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |