About 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal
3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal (PubChem CID 83843617) has the molecular formula C9H13BrN2O
and a molecular weight of 245.12 g/mol. Its IUPAC name is 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal.
Molecular Properties
| Compound Name | 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal |
| PubChem CID | 83843617 |
| Molecular Formula | C9H13BrN2O |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal |
| SMILES | Cc1nn(C)c(C(C)CC=O)c1Br |
| InChI | InChI=1S/C9H13BrN2O/c1-6(4-5-13)9-8(10)7(2)11-12(9)3/h5-6H,4H2,1-3H3 |
| InChIKey | PWHAIIKSDZRNCM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal?
The IUPAC name of 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal (CID 83843617) is 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal.
What is the SMILES notation for 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal?
The canonical SMILES for 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal is Cc1nn(C)c(C(C)CC=O)c1Br.
What is the InChIKey of 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal?
The InChIKey is PWHAIIKSDZRNCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN2O/c1-6(4-5-13)9-8(10)7(2)11-12(9)3/h5-6H,4H2,1-3H3.
What are the key properties of 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal?
3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal has a molecular weight of 245.12 g/mol, XLogP of 2.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-1,3-dimethylpyrazol-5-yl)butanal is sourced from PubChem (CID 83843617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).