3-bromo-1,2-benzothiazole-5-carboxylic acid

C8H4BrNO2S — CID 83844244

IUPAC3-bromo-1,2-benzothiazole-5-carboxylic acid
SMILESO=C(O)c1ccc2snc(Br)c2c1
InChIInChI=1S/C8H4BrNO2S/c9-7-5-3-4(8(11)12)1-2-6(5)13-10-7/h1-3H,(H,11,12)
InChIKeyWUNWYFMVNPOJEY-UHFFFAOYSA-N
MW258.10 g/mol
LogP2.76
Rot. Bonds1

About 3-bromo-1,2-benzothiazole-5-carboxylic acid

3-bromo-1,2-benzothiazole-5-carboxylic acid (PubChem CID 83844244) has the molecular formula C8H4BrNO2S and a molecular weight of 258.10 g/mol. Its IUPAC name is 3-bromo-1,2-benzothiazole-5-carboxylic acid.

Molecular Properties

Compound Name3-bromo-1,2-benzothiazole-5-carboxylic acid
PubChem CID83844244
Molecular FormulaC8H4BrNO2S
Molecular Weight258.10 g/mol
Exact Mass256.91
IUPAC Name3-bromo-1,2-benzothiazole-5-carboxylic acid
SMILESO=C(O)c1ccc2snc(Br)c2c1
InChIInChI=1S/C8H4BrNO2S/c9-7-5-3-4(8(11)12)1-2-6(5)13-10-7/h1-3H,(H,11,12)
InChIKeyWUNWYFMVNPOJEY-UHFFFAOYSA-N
XLogP2.76
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.10
LogP ≤ 52.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-bromo-1,2-benzothiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-1,2-benzothiazole-5-carboxylic acid?
The IUPAC name of 3-bromo-1,2-benzothiazole-5-carboxylic acid (CID 83844244) is 3-bromo-1,2-benzothiazole-5-carboxylic acid.
What is the SMILES notation for 3-bromo-1,2-benzothiazole-5-carboxylic acid?
The canonical SMILES for 3-bromo-1,2-benzothiazole-5-carboxylic acid is O=C(O)c1ccc2snc(Br)c2c1.
What is the InChIKey of 3-bromo-1,2-benzothiazole-5-carboxylic acid?
The InChIKey is WUNWYFMVNPOJEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrNO2S/c9-7-5-3-4(8(11)12)1-2-6(5)13-10-7/h1-3H,(H,11,12).
What are the key properties of 3-bromo-1,2-benzothiazole-5-carboxylic acid?
3-bromo-1,2-benzothiazole-5-carboxylic acid has a molecular weight of 258.10 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1,2-benzothiazole-5-carboxylic acid is sourced from PubChem (CID 83844244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).