C12H15BrN2 — CID 83844637
6-bromo-3-tert-butyl-1-methylimidazo[1,5-a]pyridine (PubChem CID 83844637) has the molecular formula C12H15BrN2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 6-bromo-3-tert-butyl-1-methylimidazo[1,5-a]pyridine.
| Compound Name | 6-bromo-3-tert-butyl-1-methylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 83844637 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 6-bromo-3-tert-butyl-1-methylimidazo[1,5-a]pyridine |
| SMILES | Cc1nc(C(C)(C)C)n2cc(Br)ccc12 |
| InChI | InChI=1S/C12H15BrN2/c1-8-10-6-5-9(13)7-15(10)11(14-8)12(2,3)4/h5-7H,1-4H3 |
| InChIKey | BQSQKBYQYNEUBD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |