C10H15BrN4 — CID 83844947
5-bromo-N,2-dimethyl-N-pyrrolidin-3-ylpyrimidin-4-amine (PubChem CID 83844947) has the molecular formula C10H15BrN4 and a molecular weight of 271.16 g/mol. Its IUPAC name is 5-bromo-N,2-dimethyl-N-pyrrolidin-3-ylpyrimidin-4-amine.
| Compound Name | 5-bromo-N,2-dimethyl-N-pyrrolidin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 83844947 |
| Molecular Formula | C10H15BrN4 |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 5-bromo-N,2-dimethyl-N-pyrrolidin-3-ylpyrimidin-4-amine |
| SMILES | Cc1ncc(Br)c(N(C)C2CCNC2)n1 |
| InChI | InChI=1S/C10H15BrN4/c1-7-13-6-9(11)10(14-7)15(2)8-3-4-12-5-8/h6,8,12H,3-5H2,1-2H3 |
| InChIKey | BFGJAPRDHVBDIP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |