About 5-oxo-1,2-dihydropyrazole-3-carbaldehyde
5-oxo-1,2-dihydropyrazole-3-carbaldehyde (PubChem CID 83845335) has the molecular formula C4H4N2O2
and a molecular weight of 112.09 g/mol. Its IUPAC name is 5-oxo-1,2-dihydropyrazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-oxo-1,2-dihydropyrazole-3-carbaldehyde |
| PubChem CID | 83845335 |
| Molecular Formula | C4H4N2O2 |
| Molecular Weight | 112.09 g/mol |
| Exact Mass | 112.03 |
| IUPAC Name | 5-oxo-1,2-dihydropyrazole-3-carbaldehyde |
| SMILES | O=Cc1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C4H4N2O2/c7-2-3-1-4(8)6-5-3/h1-2H,(H2,5,6,8) |
| InChIKey | JHIFKPGZTZYKJP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.09 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-oxo-1,2-dihydropyrazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-1,2-dihydropyrazole-3-carbaldehyde?
The IUPAC name of 5-oxo-1,2-dihydropyrazole-3-carbaldehyde (CID 83845335) is 5-oxo-1,2-dihydropyrazole-3-carbaldehyde.
What is the SMILES notation for 5-oxo-1,2-dihydropyrazole-3-carbaldehyde?
The canonical SMILES for 5-oxo-1,2-dihydropyrazole-3-carbaldehyde is O=Cc1cc(=O)[nH][nH]1.
What is the InChIKey of 5-oxo-1,2-dihydropyrazole-3-carbaldehyde?
The InChIKey is JHIFKPGZTZYKJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2/c7-2-3-1-4(8)6-5-3/h1-2H,(H2,5,6,8).
What are the key properties of 5-oxo-1,2-dihydropyrazole-3-carbaldehyde?
5-oxo-1,2-dihydropyrazole-3-carbaldehyde has a molecular weight of 112.09 g/mol, XLogP of -0.48, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-1,2-dihydropyrazole-3-carbaldehyde is sourced from PubChem (CID 83845335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).