About 3-cyclobutyl-4H-1,2-oxazol-5-one
3-cyclobutyl-4H-1,2-oxazol-5-one (PubChem CID 83845394) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 3-cyclobutyl-4H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 3-cyclobutyl-4H-1,2-oxazol-5-one |
| PubChem CID | 83845394 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3-cyclobutyl-4H-1,2-oxazol-5-one |
| SMILES | O=C1CC(C2CCC2)=NO1 |
| InChI | InChI=1S/C7H9NO2/c9-7-4-6(8-10-7)5-2-1-3-5/h5H,1-4H2 |
| InChIKey | UVLQWPCIMPEGOB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclobutyl-4H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutyl-4H-1,2-oxazol-5-one?
The IUPAC name of 3-cyclobutyl-4H-1,2-oxazol-5-one (CID 83845394) is 3-cyclobutyl-4H-1,2-oxazol-5-one.
What is the SMILES notation for 3-cyclobutyl-4H-1,2-oxazol-5-one?
The canonical SMILES for 3-cyclobutyl-4H-1,2-oxazol-5-one is O=C1CC(C2CCC2)=NO1.
What is the InChIKey of 3-cyclobutyl-4H-1,2-oxazol-5-one?
The InChIKey is UVLQWPCIMPEGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c9-7-4-6(8-10-7)5-2-1-3-5/h5H,1-4H2.
What are the key properties of 3-cyclobutyl-4H-1,2-oxazol-5-one?
3-cyclobutyl-4H-1,2-oxazol-5-one has a molecular weight of 139.15 g/mol, XLogP of 1.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutyl-4H-1,2-oxazol-5-one is sourced from PubChem (CID 83845394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).