About 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one
3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one (PubChem CID 83845395) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one |
| PubChem CID | 83845395 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one |
| SMILES | CC1C(=O)ON=C1C1CC1 |
| InChI | InChI=1S/C7H9NO2/c1-4-6(5-2-3-5)8-10-7(4)9/h4-5H,2-3H2,1H3 |
| InChIKey | BONPYSCRDSAGAE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one?
The IUPAC name of 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one (CID 83845395) is 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one.
What is the SMILES notation for 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one?
The canonical SMILES for 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one is CC1C(=O)ON=C1C1CC1.
What is the InChIKey of 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one?
The InChIKey is BONPYSCRDSAGAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-4-6(5-2-3-5)8-10-7(4)9/h4-5H,2-3H2,1H3.
What are the key properties of 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one?
3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one has a molecular weight of 139.15 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-4-methyl-4H-1,2-oxazol-5-one is sourced from PubChem (CID 83845395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).