About 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine
2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine (PubChem CID 83845883) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine |
| PubChem CID | 83845883 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine |
| SMILES | NCCc1cc(C2CCC2)no1 |
| InChI | InChI=1S/C9H14N2O/c10-5-4-8-6-9(11-12-8)7-2-1-3-7/h6-7H,1-5,10H2 |
| InChIKey | QKFUKNGJCYVDPF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine?
The IUPAC name of 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine (CID 83845883) is 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine.
What is the SMILES notation for 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine?
The canonical SMILES for 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine is NCCc1cc(C2CCC2)no1.
What is the InChIKey of 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine?
The InChIKey is QKFUKNGJCYVDPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c10-5-4-8-6-9(11-12-8)7-2-1-3-7/h6-7H,1-5,10H2.
What are the key properties of 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine?
2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine has a molecular weight of 166.22 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclobutyl-1,2-oxazol-5-yl)ethanamine is sourced from PubChem (CID 83845883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).