thiane-3,4-dicarboxylic acid

C7H10O4S — CID 83847121

IUPACthiane-3,4-dicarboxylic acid
SMILESO=C(O)C1CCSCC1C(=O)O
InChIInChI=1S/C7H10O4S/c8-6(9)4-1-2-12-3-5(4)7(10)11/h4-5H,1-3H2,(H,8,9)(H,10,11)
InChIKeyASMGFDAVIMSEEJ-UHFFFAOYSA-N
MW190.22 g/mol
LogP0.52
Rot. Bonds2

About thiane-3,4-dicarboxylic acid

thiane-3,4-dicarboxylic acid (PubChem CID 83847121) has the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. Its IUPAC name is thiane-3,4-dicarboxylic acid.

Molecular Properties

Compound Namethiane-3,4-dicarboxylic acid
PubChem CID83847121
Molecular FormulaC7H10O4S
Molecular Weight190.22 g/mol
Exact Mass190.03
IUPAC Namethiane-3,4-dicarboxylic acid
SMILESO=C(O)C1CCSCC1C(=O)O
InChIInChI=1S/C7H10O4S/c8-6(9)4-1-2-12-3-5(4)7(10)11/h4-5H,1-3H2,(H,8,9)(H,10,11)
InChIKeyASMGFDAVIMSEEJ-UHFFFAOYSA-N
XLogP0.52
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.22
LogP ≤ 50.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze thiane-3,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of thiane-3,4-dicarboxylic acid?
The IUPAC name of thiane-3,4-dicarboxylic acid (CID 83847121) is thiane-3,4-dicarboxylic acid.
What is the SMILES notation for thiane-3,4-dicarboxylic acid?
The canonical SMILES for thiane-3,4-dicarboxylic acid is O=C(O)C1CCSCC1C(=O)O.
What is the InChIKey of thiane-3,4-dicarboxylic acid?
The InChIKey is ASMGFDAVIMSEEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4S/c8-6(9)4-1-2-12-3-5(4)7(10)11/h4-5H,1-3H2,(H,8,9)(H,10,11).
What are the key properties of thiane-3,4-dicarboxylic acid?
thiane-3,4-dicarboxylic acid has a molecular weight of 190.22 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiane-3,4-dicarboxylic acid is sourced from PubChem (CID 83847121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).