C10H15N3O — CID 83847317
4-(1-aminoethyl)-5,6,7,8-tetrahydro-1H-quinazolin-2-one (PubChem CID 83847317) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(1-aminoethyl)-5,6,7,8-tetrahydro-1H-quinazolin-2-one.
| Compound Name | 4-(1-aminoethyl)-5,6,7,8-tetrahydro-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 83847317 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 4-(1-aminoethyl)-5,6,7,8-tetrahydro-1H-quinazolin-2-one |
| SMILES | CC(N)c1nc(=O)[nH]c2c1CCCC2 |
| InChI | InChI=1S/C10H15N3O/c1-6(11)9-7-4-2-3-5-8(7)12-10(14)13-9/h6H,2-5,11H2,1H3,(H,12,13,14) |
| InChIKey | CJATUPVHOFOJDM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |