About 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid
2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid (PubChem CID 83848433) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid |
| PubChem CID | 83848433 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid |
| SMILES | O=C(O)CN1CC(=O)Nc2ncccc21 |
| InChI | InChI=1S/C9H9N3O3/c13-7-4-12(5-8(14)15)6-2-1-3-10-9(6)11-7/h1-3H,4-5H2,(H,14,15)(H,10,11,13) |
| InChIKey | ZZPCDCPIJQYIAD-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid?
The IUPAC name of 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid (CID 83848433) is 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid.
What is the SMILES notation for 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid?
The canonical SMILES for 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid is O=C(O)CN1CC(=O)Nc2ncccc21.
What is the InChIKey of 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid?
The InChIKey is ZZPCDCPIJQYIAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3/c13-7-4-12(5-8(14)15)6-2-1-3-10-9(6)11-7/h1-3H,4-5H2,(H,14,15)(H,10,11,13).
What are the key properties of 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid?
2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid has a molecular weight of 207.19 g/mol, XLogP of -0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-2,4-dihydropyrido[2,3-b]pyrazin-1-yl)acetic acid is sourced from PubChem (CID 83848433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).