About 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole
3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole (PubChem CID 83848810) has the molecular formula C10H14N2OS
and a molecular weight of 210.30 g/mol. Its IUPAC name is 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole.
Molecular Properties
| Compound Name | 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole |
| PubChem CID | 83848810 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole |
| SMILES | C1CC(c2onc3c2CNC3)CCS1 |
| InChI | InChI=1S/C10H14N2OS/c1-3-14-4-2-7(1)10-8-5-11-6-9(8)12-13-10/h7,11H,1-6H2 |
| InChIKey | DHGHSBYYUYTSLL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole?
The IUPAC name of 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole (CID 83848810) is 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole.
What is the SMILES notation for 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole?
The canonical SMILES for 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole is C1CC(c2onc3c2CNC3)CCS1.
What is the InChIKey of 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole?
The InChIKey is DHGHSBYYUYTSLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2OS/c1-3-14-4-2-7(1)10-8-5-11-6-9(8)12-13-10/h7,11H,1-6H2.
What are the key properties of 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole?
3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole has a molecular weight of 210.30 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(thian-4-yl)-5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole is sourced from PubChem (CID 83848810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).