About 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid
5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid (PubChem CID 83849002) has the molecular formula C9H11NO3S
and a molecular weight of 213.26 g/mol. Its IUPAC name is 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid |
| PubChem CID | 83849002 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(C2CCCSC2)o1 |
| InChI | InChI=1S/C9H11NO3S/c11-9(12)8-10-4-7(13-8)6-2-1-3-14-5-6/h4,6H,1-3,5H2,(H,11,12) |
| InChIKey | KZUKJPVRNHQXPJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid?
The IUPAC name of 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid (CID 83849002) is 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid.
What is the SMILES notation for 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid?
The canonical SMILES for 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid is O=C(O)c1ncc(C2CCCSC2)o1.
What is the InChIKey of 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid?
The InChIKey is KZUKJPVRNHQXPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3S/c11-9(12)8-10-4-7(13-8)6-2-1-3-14-5-6/h4,6H,1-3,5H2,(H,11,12).
What are the key properties of 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid?
5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid has a molecular weight of 213.26 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(thian-3-yl)-1,3-oxazole-2-carboxylic acid is sourced from PubChem (CID 83849002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).