C10H9ClN2O2 — CID 83849997
2-(6-chloro-3-oxo-2,4-dihydroquinoxalin-1-yl)acetaldehyde (PubChem CID 83849997) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-2,4-dihydroquinoxalin-1-yl)acetaldehyde.
| Compound Name | 2-(6-chloro-3-oxo-2,4-dihydroquinoxalin-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 83849997 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-(6-chloro-3-oxo-2,4-dihydroquinoxalin-1-yl)acetaldehyde |
| SMILES | O=CCN1CC(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H9ClN2O2/c11-7-1-2-9-8(5-7)12-10(15)6-13(9)3-4-14/h1-2,4-5H,3,6H2,(H,12,15) |
| InChIKey | CBGPBUBAGWNUMB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|