C14H16N2O — CID 83850193
3-(2,4-dimethylphenyl)-4,5,6,7-tetrahydro-[1,2]oxazolo[3,4-c]pyridine (PubChem CID 83850193) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-4,5,6,7-tetrahydro-[1,2]oxazolo[3,4-c]pyridine.
| Compound Name | 3-(2,4-dimethylphenyl)-4,5,6,7-tetrahydro-[1,2]oxazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 83850193 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-4,5,6,7-tetrahydro-[1,2]oxazolo[3,4-c]pyridine |
| SMILES | Cc1ccc(-c2onc3c2CCNC3)c(C)c1 |
| InChI | InChI=1S/C14H16N2O/c1-9-3-4-11(10(2)7-9)14-12-5-6-15-8-13(12)16-17-14/h3-4,7,15H,5-6,8H2,1-2H3 |
| InChIKey | AABSIYNYYVFDOZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |