C6H10N4O — CID 83851764
4-amino-6-(2-aminoethyl)-1H-pyrimidin-2-one (PubChem CID 83851764) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is 4-amino-6-(2-aminoethyl)-1H-pyrimidin-2-one.
| Compound Name | 4-amino-6-(2-aminoethyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 83851764 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 4-amino-6-(2-aminoethyl)-1H-pyrimidin-2-one |
| SMILES | NCCc1cc(N)nc(=O)[nH]1 |
| InChI | InChI=1S/C6H10N4O/c7-2-1-4-3-5(8)10-6(11)9-4/h3H,1-2,7H2,(H3,8,9,10,11) |
| InChIKey | MIKKPZRATYFMIB-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |