C7H12N4O — CID 83851816
4-(2-aminoethyl)-6-methoxypyrimidin-2-amine (PubChem CID 83851816) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 4-(2-aminoethyl)-6-methoxypyrimidin-2-amine.
| Compound Name | 4-(2-aminoethyl)-6-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 83851816 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 4-(2-aminoethyl)-6-methoxypyrimidin-2-amine |
| SMILES | COc1cc(CCN)nc(N)n1 |
| InChI | InChI=1S/C7H12N4O/c1-12-6-4-5(2-3-8)10-7(9)11-6/h4H,2-3,8H2,1H3,(H2,9,10,11) |
| InChIKey | YEUFTNCSXXZBKS-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |