About 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid
2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid (PubChem CID 83852450) has the molecular formula C10H12N2O4
and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid |
| PubChem CID | 83852450 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid |
| SMILES | O=C(O)Cc1cc(=O)[nH]c(=O)n1C1CCC1 |
| InChI | InChI=1S/C10H12N2O4/c13-8-4-7(5-9(14)15)12(10(16)11-8)6-2-1-3-6/h4,6H,1-3,5H2,(H,14,15)(H,11,13,16) |
| InChIKey | NVEWQJPRLRRSMH-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid?
The IUPAC name of 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid (CID 83852450) is 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid.
What is the SMILES notation for 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid?
The canonical SMILES for 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid is O=C(O)Cc1cc(=O)[nH]c(=O)n1C1CCC1.
What is the InChIKey of 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid?
The InChIKey is NVEWQJPRLRRSMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4/c13-8-4-7(5-9(14)15)12(10(16)11-8)6-2-1-3-6/h4,6H,1-3,5H2,(H,14,15)(H,11,13,16).
What are the key properties of 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid?
2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid has a molecular weight of 224.22 g/mol, XLogP of -0.11, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclobutyl-2,6-dioxopyrimidin-4-yl)acetic acid is sourced from PubChem (CID 83852450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).