C11H14N2O2 — CID 83853096
9-amino-3,4-dimethyl-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 83853096) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 9-amino-3,4-dimethyl-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | 9-amino-3,4-dimethyl-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 83853096 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 9-amino-3,4-dimethyl-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | CC1COc2c(N)cccc2C(=O)N1C |
| InChI | InChI=1S/C11H14N2O2/c1-7-6-15-10-8(11(14)13(7)2)4-3-5-9(10)12/h3-5,7H,6,12H2,1-2H3 |
| InChIKey | HFSNAUQYECEIBQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|