About 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one
8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 83853392) has the molecular formula C10H10BrNO2
and a molecular weight of 256.10 g/mol. Its IUPAC name is 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one.
Molecular Properties
| Compound Name | 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one |
| PubChem CID | 83853392 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | CN1CCOc2cc(Br)ccc2C1=O |
| InChI | InChI=1S/C10H10BrNO2/c1-12-4-5-14-9-6-7(11)2-3-8(9)10(12)13/h2-3,6H,4-5H2,1H3 |
| InChIKey | FBIZQRRTHLGXRW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one?
The IUPAC name of 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one (CID 83853392) is 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one.
What is the SMILES notation for 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one?
The canonical SMILES for 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one is CN1CCOc2cc(Br)ccc2C1=O.
What is the InChIKey of 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one?
The InChIKey is FBIZQRRTHLGXRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO2/c1-12-4-5-14-9-6-7(11)2-3-8(9)10(12)13/h2-3,6H,4-5H2,1H3.
What are the key properties of 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one?
8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one has a molecular weight of 256.10 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazepin-5-one is sourced from PubChem (CID 83853392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).