About 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride
2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride (PubChem CID 83853467) has the molecular formula C11H10ClNO3S
and a molecular weight of 271.72 g/mol. Its IUPAC name is 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride |
| PubChem CID | 83853467 |
| Molecular Formula | C11H10ClNO3S |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Cl)cc2C12CCC2 |
| InChI | InChI=1S/C11H10ClNO3S/c12-17(15,16)7-2-3-9-8(6-7)11(4-1-5-11)10(14)13-9/h2-3,6H,1,4-5H2,(H,13,14) |
| InChIKey | AMDDXRZDTSJGJD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride?
The IUPAC name of 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride (CID 83853467) is 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride.
What is the SMILES notation for 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride?
The canonical SMILES for 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride is O=C1Nc2ccc(S(=O)(=O)Cl)cc2C12CCC2.
What is the InChIKey of 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride?
The InChIKey is AMDDXRZDTSJGJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO3S/c12-17(15,16)7-2-3-9-8(6-7)11(4-1-5-11)10(14)13-9/h2-3,6H,1,4-5H2,(H,13,14).
What are the key properties of 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride?
2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride has a molecular weight of 271.72 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxospiro[1H-indole-3,1'-cyclobutane]-5-sulfonyl chloride is sourced from PubChem (CID 83853467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).