C9H9F2N — CID 83853904
4,6-difluoro-1,2,3,4-tetrahydroquinoline (PubChem CID 83853904) has the molecular formula C9H9F2N and a molecular weight of 169.17 g/mol. Its IUPAC name is 4,6-difluoro-1,2,3,4-tetrahydroquinoline.
| Compound Name | 4,6-difluoro-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 83853904 |
| Molecular Formula | C9H9F2N |
| Molecular Weight | 169.17 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 4,6-difluoro-1,2,3,4-tetrahydroquinoline |
| SMILES | Fc1ccc2c(c1)C(F)CCN2 |
| InChI | InChI=1S/C9H9F2N/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5,8,12H,3-4H2 |
| InChIKey | FNQCVXWZAXFQOT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.17 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |