4-fluoro-1,1-dioxothiolane-3-carboxylic acid

C5H7FO4S — CID 83854510

IUPAC4-fluoro-1,1-dioxothiolane-3-carboxylic acid
SMILESO=C(O)C1CS(=O)(=O)CC1F
InChIInChI=1S/C5H7FO4S/c6-4-2-11(9,10)1-3(4)5(7)8/h3-4H,1-2H2,(H,7,8)
InChIKeyWHRBIQPAMBUHMI-UHFFFAOYSA-N
MW182.17 g/mol
LogP-0.55
Rot. Bonds1

About 4-fluoro-1,1-dioxothiolane-3-carboxylic acid

4-fluoro-1,1-dioxothiolane-3-carboxylic acid (PubChem CID 83854510) has the molecular formula C5H7FO4S and a molecular weight of 182.17 g/mol. Its IUPAC name is 4-fluoro-1,1-dioxothiolane-3-carboxylic acid.

Molecular Properties

Compound Name4-fluoro-1,1-dioxothiolane-3-carboxylic acid
PubChem CID83854510
Molecular FormulaC5H7FO4S
Molecular Weight182.17 g/mol
Exact Mass182.00
IUPAC Name4-fluoro-1,1-dioxothiolane-3-carboxylic acid
SMILESO=C(O)C1CS(=O)(=O)CC1F
InChIInChI=1S/C5H7FO4S/c6-4-2-11(9,10)1-3(4)5(7)8/h3-4H,1-2H2,(H,7,8)
InChIKeyWHRBIQPAMBUHMI-UHFFFAOYSA-N
XLogP-0.55
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.17
LogP ≤ 5-0.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-fluoro-1,1-dioxothiolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-fluoro-1,1-dioxothiolane-3-carboxylic acid?
The IUPAC name of 4-fluoro-1,1-dioxothiolane-3-carboxylic acid (CID 83854510) is 4-fluoro-1,1-dioxothiolane-3-carboxylic acid.
What is the SMILES notation for 4-fluoro-1,1-dioxothiolane-3-carboxylic acid?
The canonical SMILES for 4-fluoro-1,1-dioxothiolane-3-carboxylic acid is O=C(O)C1CS(=O)(=O)CC1F.
What is the InChIKey of 4-fluoro-1,1-dioxothiolane-3-carboxylic acid?
The InChIKey is WHRBIQPAMBUHMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FO4S/c6-4-2-11(9,10)1-3(4)5(7)8/h3-4H,1-2H2,(H,7,8).
What are the key properties of 4-fluoro-1,1-dioxothiolane-3-carboxylic acid?
4-fluoro-1,1-dioxothiolane-3-carboxylic acid has a molecular weight of 182.17 g/mol, XLogP of -0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,1-dioxothiolane-3-carboxylic acid is sourced from PubChem (CID 83854510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).