About 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile
5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile (PubChem CID 83854576) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile |
| PubChem CID | 83854576 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile |
| SMILES | Cn1nc(C#N)c2c1CC(O)C2 |
| InChI | InChI=1S/C8H9N3O/c1-11-8-3-5(12)2-6(8)7(4-9)10-11/h5,12H,2-3H2,1H3 |
| InChIKey | MXLRBKNDOBKJBR-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile?
The IUPAC name of 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile (CID 83854576) is 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile.
What is the SMILES notation for 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile?
The canonical SMILES for 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile is Cn1nc(C#N)c2c1CC(O)C2.
What is the InChIKey of 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile?
The InChIKey is MXLRBKNDOBKJBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-11-8-3-5(12)2-6(8)7(4-9)10-11/h5,12H,2-3H2,1H3.
What are the key properties of 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile?
5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile has a molecular weight of 163.18 g/mol, XLogP of -0.25, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbonitrile is sourced from PubChem (CID 83854576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).