C10H12F2N2O2 — CID 83854735
ethyl 6,6-difluoro-1,4,5,7-tetrahydroindazole-3-carboxylate (PubChem CID 83854735) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is ethyl 6,6-difluoro-1,4,5,7-tetrahydroindazole-3-carboxylate.
| Compound Name | ethyl 6,6-difluoro-1,4,5,7-tetrahydroindazole-3-carboxylate |
|---|---|
| PubChem CID | 83854735 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | ethyl 6,6-difluoro-1,4,5,7-tetrahydroindazole-3-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c2c1CCC(F)(F)C2 |
| InChI | InChI=1S/C10H12F2N2O2/c1-2-16-9(15)8-6-3-4-10(11,12)5-7(6)13-14-8/h2-5H2,1H3,(H,13,14) |
| InChIKey | VOQAHUIPGGKBHS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |