About 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine
2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine (PubChem CID 83854849) has the molecular formula C10H9BrF3N
and a molecular weight of 280.09 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine.
Molecular Properties
| Compound Name | 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine |
| PubChem CID | 83854849 |
| Molecular Formula | C10H9BrF3N |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine |
| SMILES | Fc1ccc(Br)c(C2CC(F)(F)CN2)c1 |
| InChI | InChI=1S/C10H9BrF3N/c11-8-2-1-6(12)3-7(8)9-4-10(13,14)5-15-9/h1-3,9,15H,4-5H2 |
| InChIKey | WDDHWNQCFNCQNU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine?
The IUPAC name of 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine (CID 83854849) is 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine.
What is the SMILES notation for 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine?
The canonical SMILES for 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine is Fc1ccc(Br)c(C2CC(F)(F)CN2)c1.
What is the InChIKey of 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine?
The InChIKey is WDDHWNQCFNCQNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF3N/c11-8-2-1-6(12)3-7(8)9-4-10(13,14)5-15-9/h1-3,9,15H,4-5H2.
What are the key properties of 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine?
2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine has a molecular weight of 280.09 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-5-fluorophenyl)-4,4-difluoropyrrolidine is sourced from PubChem (CID 83854849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).