C9H12N2O2S2 — CID 83856382
4-methylsulfonyl-5,6,7,8-tetrahydro-1H-quinazoline-2-thione (PubChem CID 83856382) has the molecular formula C9H12N2O2S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-methylsulfonyl-5,6,7,8-tetrahydro-1H-quinazoline-2-thione.
| Compound Name | 4-methylsulfonyl-5,6,7,8-tetrahydro-1H-quinazoline-2-thione |
|---|---|
| PubChem CID | 83856382 |
| Molecular Formula | C9H12N2O2S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 4-methylsulfonyl-5,6,7,8-tetrahydro-1H-quinazoline-2-thione |
| SMILES | CS(=O)(=O)c1nc(=S)[nH]c2c1CCCC2 |
| InChI | InChI=1S/C9H12N2O2S2/c1-15(12,13)8-6-4-2-3-5-7(6)10-9(14)11-8/h2-5H2,1H3,(H,10,11,14) |
| InChIKey | FCTWSCUVBDCKAF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|