C8H10N2O2S2 — CID 83856400
4-methylsulfonyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2-thione (PubChem CID 83856400) has the molecular formula C8H10N2O2S2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-methylsulfonyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2-thione.
| Compound Name | 4-methylsulfonyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 83856400 |
| Molecular Formula | C8H10N2O2S2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 4-methylsulfonyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2-thione |
| SMILES | CS(=O)(=O)c1nc(=S)[nH]c2c1CCC2 |
| InChI | InChI=1S/C8H10N2O2S2/c1-14(11,12)7-5-3-2-4-6(5)9-8(13)10-7/h2-4H2,1H3,(H,9,10,13) |
| InChIKey | GCADUSSUJIJYLI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|