2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid

C8H12N2O3 — CID 83856701

IUPAC2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid
SMILESCC(C(=O)O)c1cc(=O)n(C)n1C
InChIInChI=1S/C8H12N2O3/c1-5(8(12)13)6-4-7(11)10(3)9(6)2/h4-5H,1-3H3,(H,12,13)
InChIKeyPOTIZQQHOZIXPT-UHFFFAOYSA-N
MW184.19 g/mol
LogP-0.09
Rot. Bonds2

About 2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid

2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid (PubChem CID 83856701) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid.

Molecular Properties

Compound Name2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid
PubChem CID83856701
Molecular FormulaC8H12N2O3
Molecular Weight184.19 g/mol
Exact Mass184.08
IUPAC Name2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid
SMILESCC(C(=O)O)c1cc(=O)n(C)n1C
InChIInChI=1S/C8H12N2O3/c1-5(8(12)13)6-4-7(11)10(3)9(6)2/h4-5H,1-3H3,(H,12,13)
InChIKeyPOTIZQQHOZIXPT-UHFFFAOYSA-N
XLogP-0.09
TPSA64.23 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 5-0.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid?
The IUPAC name of 2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid (CID 83856701) is 2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid.
What is the SMILES notation for 2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid?
The canonical SMILES for 2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid is CC(C(=O)O)c1cc(=O)n(C)n1C.
What is the InChIKey of 2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid?
The InChIKey is POTIZQQHOZIXPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-5(8(12)13)6-4-7(11)10(3)9(6)2/h4-5H,1-3H3,(H,12,13).
What are the key properties of 2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid?
2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid has a molecular weight of 184.19 g/mol, XLogP of -0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dimethyl-5-oxopyrazol-3-yl)propanoic acid is sourced from PubChem (CID 83856701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).