C10H16N2O3 — CID 83856729
3-(1,2-dimethyl-5-oxopyrazol-3-yl)-3-methylbutanoic acid (PubChem CID 83856729) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-(1,2-dimethyl-5-oxopyrazol-3-yl)-3-methylbutanoic acid.
| Compound Name | 3-(1,2-dimethyl-5-oxopyrazol-3-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 83856729 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 3-(1,2-dimethyl-5-oxopyrazol-3-yl)-3-methylbutanoic acid |
| SMILES | Cn1c(C(C)(C)CC(=O)O)cc(=O)n1C |
| InChI | InChI=1S/C10H16N2O3/c1-10(2,6-9(14)15)7-5-8(13)12(4)11(7)3/h5H,6H2,1-4H3,(H,14,15) |
| InChIKey | LRFKYAUELYKNAS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |