About 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid
1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid (PubChem CID 83856946) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid |
| PubChem CID | 83856946 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid |
| SMILES | Cc1c(C2(C(=O)O)CC2)[nH][nH]c1=O |
| InChI | InChI=1S/C8H10N2O3/c1-4-5(9-10-6(4)11)8(2-3-8)7(12)13/h2-3H2,1H3,(H,12,13)(H2,9,10,11) |
| InChIKey | VMXCDAVZLWQLFV-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid?
The IUPAC name of 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid (CID 83856946) is 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid is Cc1c(C2(C(=O)O)CC2)[nH][nH]c1=O.
What is the InChIKey of 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid?
The InChIKey is VMXCDAVZLWQLFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-4-5(9-10-6(4)11)8(2-3-8)7(12)13/h2-3H2,1H3,(H,12,13)(H2,9,10,11).
What are the key properties of 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid?
1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid has a molecular weight of 182.18 g/mol, XLogP of 0.13, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 83856946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).