About 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid
2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid (PubChem CID 83856973) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid |
| PubChem CID | 83856973 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid |
| SMILES | Cc1c(CC(C)(C)C(=O)O)[nH][nH]c1=O |
| InChI | InChI=1S/C9H14N2O3/c1-5-6(10-11-7(5)12)4-9(2,3)8(13)14/h4H2,1-3H3,(H,13,14)(H2,10,11,12) |
| InChIKey | PXUXJXMAZMTHKA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid?
The IUPAC name of 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid (CID 83856973) is 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid.
What is the SMILES notation for 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid?
The canonical SMILES for 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid is Cc1c(CC(C)(C)C(=O)O)[nH][nH]c1=O.
What is the InChIKey of 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid?
The InChIKey is PXUXJXMAZMTHKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-5-6(10-11-7(5)12)4-9(2,3)8(13)14/h4H2,1-3H3,(H,13,14)(H2,10,11,12).
What are the key properties of 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid?
2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid has a molecular weight of 198.22 g/mol, XLogP of 0.66, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-(4-methyl-5-oxo-1,2-dihydropyrazol-3-yl)propanoic acid is sourced from PubChem (CID 83856973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).