C8H12N4O3 — CID 83857337
4-amino-2-(4-amino-2-oxo-1H-pyrimidin-6-yl)butanoic acid (PubChem CID 83857337) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 4-amino-2-(4-amino-2-oxo-1H-pyrimidin-6-yl)butanoic acid.
| Compound Name | 4-amino-2-(4-amino-2-oxo-1H-pyrimidin-6-yl)butanoic acid |
|---|---|
| PubChem CID | 83857337 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 4-amino-2-(4-amino-2-oxo-1H-pyrimidin-6-yl)butanoic acid |
| SMILES | NCCC(C(=O)O)c1cc(N)nc(=O)[nH]1 |
| InChI | InChI=1S/C8H12N4O3/c9-2-1-4(7(13)14)5-3-6(10)12-8(15)11-5/h3-4H,1-2,9H2,(H,13,14)(H3,10,11,12,15) |
| InChIKey | SXBKWSFKZMYKQA-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 135.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |