C9H12N2O3 — CID 83858504
2-(6-methyl-2-oxo-1H-pyrimidin-4-yl)butanoic acid (PubChem CID 83858504) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(6-methyl-2-oxo-1H-pyrimidin-4-yl)butanoic acid.
| Compound Name | 2-(6-methyl-2-oxo-1H-pyrimidin-4-yl)butanoic acid |
|---|---|
| PubChem CID | 83858504 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-(6-methyl-2-oxo-1H-pyrimidin-4-yl)butanoic acid |
| SMILES | CCC(C(=O)O)c1cc(C)[nH]c(=O)n1 |
| InChI | InChI=1S/C9H12N2O3/c1-3-6(8(12)13)7-4-5(2)10-9(14)11-7/h4,6H,3H2,1-2H3,(H,12,13)(H,10,11,14) |
| InChIKey | OVRDYUKJRCUNIP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |