About 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile
2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile (PubChem CID 83859301) has the molecular formula C9H7N3O
and a molecular weight of 173.17 g/mol. Its IUPAC name is 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile.
Molecular Properties
| Compound Name | 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile |
| PubChem CID | 83859301 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile |
| SMILES | CC(C#N)c1nc2ncccc2o1 |
| InChI | InChI=1S/C9H7N3O/c1-6(5-10)9-12-8-7(13-9)3-2-4-11-8/h2-4,6H,1H3 |
| InChIKey | PZXXHLCWFZDFTQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile?
The IUPAC name of 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile (CID 83859301) is 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile.
What is the SMILES notation for 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile?
The canonical SMILES for 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile is CC(C#N)c1nc2ncccc2o1.
What is the InChIKey of 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile?
The InChIKey is PZXXHLCWFZDFTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O/c1-6(5-10)9-12-8-7(13-9)3-2-4-11-8/h2-4,6H,1H3.
What are the key properties of 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile?
2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile has a molecular weight of 173.17 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1,3]oxazolo[4,5-b]pyridin-2-yl)propanenitrile is sourced from PubChem (CID 83859301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).