C13H14FNO2 — CID 83860165
2-(5-fluoro-1-propan-2-ylindol-2-yl)acetic acid (PubChem CID 83860165) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is 2-(5-fluoro-1-propan-2-ylindol-2-yl)acetic acid.
| Compound Name | 2-(5-fluoro-1-propan-2-ylindol-2-yl)acetic acid |
|---|---|
| PubChem CID | 83860165 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-(5-fluoro-1-propan-2-ylindol-2-yl)acetic acid |
| SMILES | CC(C)n1c(CC(=O)O)cc2cc(F)ccc21 |
| InChI | InChI=1S/C13H14FNO2/c1-8(2)15-11(7-13(16)17)6-9-5-10(14)3-4-12(9)15/h3-6,8H,7H2,1-2H3,(H,16,17) |
| InChIKey | VVOMQHZZYQJSFO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |