About 7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid
7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid (PubChem CID 83860242) has the molecular formula C10H8F3NO2
and a molecular weight of 231.17 g/mol. Its IUPAC name is 7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid.
Analyze 7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid?
The IUPAC name of 7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid (CID 83860242) is 7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid.
What is the SMILES notation for 7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid?
The canonical SMILES for 7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid is O=C(O)C1CNc2c1cccc2C(F)(F)F.
What is the InChIKey of 7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid?
The InChIKey is KYKIAOXAWAURQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NO2/c11-10(12,13)7-3-1-2-5-6(9(15)16)4-14-8(5)7/h1-3,6,14H,4H2,(H,15,16).
What are the key properties of 7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid?
7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid has a molecular weight of 231.17 g/mol, XLogP of 2.30, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(trifluoromethyl)-2,3-dihydro-1H-indole-3-carboxylic acid is sourced from PubChem (CID 83860242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).