About 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine
2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine (PubChem CID 83860329) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine.
Molecular Properties
| Compound Name | 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine |
| PubChem CID | 83860329 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine |
| SMILES | Cc1ccc2c(c1)C(C(C)CN)CN2 |
| InChI | InChI=1S/C12H18N2/c1-8-3-4-12-10(5-8)11(7-14-12)9(2)6-13/h3-5,9,11,14H,6-7,13H2,1-2H3 |
| InChIKey | NSXMQQPMWBOSTA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine?
The IUPAC name of 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine (CID 83860329) is 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine.
What is the SMILES notation for 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine?
The canonical SMILES for 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine is Cc1ccc2c(c1)C(C(C)CN)CN2.
What is the InChIKey of 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine?
The InChIKey is NSXMQQPMWBOSTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-8-3-4-12-10(5-8)11(7-14-12)9(2)6-13/h3-5,9,11,14H,6-7,13H2,1-2H3.
What are the key properties of 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine?
2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine has a molecular weight of 190.29 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine is sourced from PubChem (CID 83860329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).