About 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine
3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine (PubChem CID 83860377) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine |
| PubChem CID | 83860377 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine |
| SMILES | Cc1ccc(C)c2c1NCC2CCCN |
| InChI | InChI=1S/C13H20N2/c1-9-5-6-10(2)13-12(9)11(8-15-13)4-3-7-14/h5-6,11,15H,3-4,7-8,14H2,1-2H3 |
| InChIKey | JCAKWHYEMHMVQH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine?
The IUPAC name of 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine (CID 83860377) is 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine.
What is the SMILES notation for 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine?
The canonical SMILES for 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine is Cc1ccc(C)c2c1NCC2CCCN.
What is the InChIKey of 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine?
The InChIKey is JCAKWHYEMHMVQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-9-5-6-10(2)13-12(9)11(8-15-13)4-3-7-14/h5-6,11,15H,3-4,7-8,14H2,1-2H3.
What are the key properties of 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine?
3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine has a molecular weight of 204.32 g/mol, XLogP of 2.55, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,7-dimethyl-2,3-dihydro-1H-indol-3-yl)propan-1-amine is sourced from PubChem (CID 83860377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).