C12H18N2O — CID 83860690
2-amino-1-(7-ethyl-2,3-dihydro-1H-indol-2-yl)ethanol (PubChem CID 83860690) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-amino-1-(7-ethyl-2,3-dihydro-1H-indol-2-yl)ethanol.
| Compound Name | 2-amino-1-(7-ethyl-2,3-dihydro-1H-indol-2-yl)ethanol |
|---|---|
| PubChem CID | 83860690 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-amino-1-(7-ethyl-2,3-dihydro-1H-indol-2-yl)ethanol |
| SMILES | CCc1cccc2c1NC(C(O)CN)C2 |
| InChI | InChI=1S/C12H18N2O/c1-2-8-4-3-5-9-6-10(11(15)7-13)14-12(8)9/h3-5,10-11,14-15H,2,6-7,13H2,1H3 |
| InChIKey | CZIHCSWNSYCTJN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |