About 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one
3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one (PubChem CID 83861317) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one.
Molecular Properties
| Compound Name | 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one |
| PubChem CID | 83861317 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one |
| SMILES | CC(C)(C)c1n[nH]c2c1C(=O)CC2 |
| InChI | InChI=1S/C10H14N2O/c1-10(2,3)9-8-6(11-12-9)4-5-7(8)13/h4-5H2,1-3H3,(H,11,12) |
| InChIKey | LOBANMZMUXEUEE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one?
The IUPAC name of 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one (CID 83861317) is 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one.
What is the SMILES notation for 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one?
The canonical SMILES for 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one is CC(C)(C)c1n[nH]c2c1C(=O)CC2.
What is the InChIKey of 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one?
The InChIKey is LOBANMZMUXEUEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-10(2,3)9-8-6(11-12-9)4-5-7(8)13/h4-5H2,1-3H3,(H,11,12).
What are the key properties of 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one?
3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one has a molecular weight of 178.23 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5,6-dihydro-1H-cyclopenta[c]pyrazol-4-one is sourced from PubChem (CID 83861317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).