1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid

C8H10N2O2 — CID 83861578

IUPAC1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid
SMILESCn1ncc2c1CCC2C(=O)O
InChIInChI=1S/C8H10N2O2/c1-10-7-3-2-5(8(11)12)6(7)4-9-10/h4-5H,2-3H2,1H3,(H,11,12)
InChIKeyJQRZIZSZDILTTJ-UHFFFAOYSA-N
MW166.18 g/mol
LogP0.53
Rot. Bonds1

About 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid

1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid (PubChem CID 83861578) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid.

Molecular Properties

Compound Name1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid
PubChem CID83861578
Molecular FormulaC8H10N2O2
Molecular Weight166.18 g/mol
Exact Mass166.07
IUPAC Name1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid
SMILESCn1ncc2c1CCC2C(=O)O
InChIInChI=1S/C8H10N2O2/c1-10-7-3-2-5(8(11)12)6(7)4-9-10/h4-5H,2-3H2,1H3,(H,11,12)
InChIKeyJQRZIZSZDILTTJ-UHFFFAOYSA-N
XLogP0.53
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.18
LogP ≤ 50.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid?
The IUPAC name of 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid (CID 83861578) is 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid.
What is the SMILES notation for 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid?
The canonical SMILES for 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid is Cn1ncc2c1CCC2C(=O)O.
What is the InChIKey of 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid?
The InChIKey is JQRZIZSZDILTTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-10-7-3-2-5(8(11)12)6(7)4-9-10/h4-5H,2-3H2,1H3,(H,11,12).
What are the key properties of 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid?
1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid has a molecular weight of 166.18 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-4-carboxylic acid is sourced from PubChem (CID 83861578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).