About 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine
2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine (PubChem CID 83861841) has the molecular formula C13H12FN3
and a molecular weight of 229.26 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine |
| PubChem CID | 83861841 |
| Molecular Formula | C13H12FN3 |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine |
| SMILES | NC1CCc2nc(-c3ccccc3F)ncc21 |
| InChI | InChI=1S/C13H12FN3/c14-10-4-2-1-3-8(10)13-16-7-9-11(15)5-6-12(9)17-13/h1-4,7,11H,5-6,15H2 |
| InChIKey | WFOLPVICEWPROG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine?
The IUPAC name of 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine (CID 83861841) is 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine.
What is the SMILES notation for 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine?
The canonical SMILES for 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine is NC1CCc2nc(-c3ccccc3F)ncc21.
What is the InChIKey of 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine?
The InChIKey is WFOLPVICEWPROG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN3/c14-10-4-2-1-3-8(10)13-16-7-9-11(15)5-6-12(9)17-13/h1-4,7,11H,5-6,15H2.
What are the key properties of 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine?
2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine has a molecular weight of 229.26 g/mol, XLogP of 2.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-5-amine is sourced from PubChem (CID 83861841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).