1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid

C10H14N2O2 — CID 83861914

IUPAC1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid
SMILESCc1nn(C)c2c1C(C(=O)O)CCC2
InChIInChI=1S/C10H14N2O2/c1-6-9-7(10(13)14)4-3-5-8(9)12(2)11-6/h7H,3-5H2,1-2H3,(H,13,14)
InChIKeyXFLOUWYFOVQXIY-UHFFFAOYSA-N
MW194.23 g/mol
LogP1.23
Rot. Bonds1

About 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid

1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid (PubChem CID 83861914) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid.

Molecular Properties

Compound Name1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid
PubChem CID83861914
Molecular FormulaC10H14N2O2
Molecular Weight194.23 g/mol
Exact Mass194.11
IUPAC Name1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid
SMILESCc1nn(C)c2c1C(C(=O)O)CCC2
InChIInChI=1S/C10H14N2O2/c1-6-9-7(10(13)14)4-3-5-8(9)12(2)11-6/h7H,3-5H2,1-2H3,(H,13,14)
InChIKeyXFLOUWYFOVQXIY-UHFFFAOYSA-N
XLogP1.23
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.23
LogP ≤ 51.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The IUPAC name of 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid (CID 83861914) is 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid.
What is the SMILES notation for 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The canonical SMILES for 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid is Cc1nn(C)c2c1C(C(=O)O)CCC2.
What is the InChIKey of 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The InChIKey is XFLOUWYFOVQXIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-6-9-7(10(13)14)4-3-5-8(9)12(2)11-6/h7H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid has a molecular weight of 194.23 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid is sourced from PubChem (CID 83861914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).