About 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid
1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid (PubChem CID 83861914) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid.
Analyze 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The IUPAC name of 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid (CID 83861914) is 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid.
What is the SMILES notation for 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The canonical SMILES for 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid is Cc1nn(C)c2c1C(C(=O)O)CCC2.
What is the InChIKey of 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The InChIKey is XFLOUWYFOVQXIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-6-9-7(10(13)14)4-3-5-8(9)12(2)11-6/h7H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid has a molecular weight of 194.23 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid is sourced from PubChem (CID 83861914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).