C10H14N2O2 — CID 83862101
6,6-dimethyl-1,4,5,7-tetrahydroindazole-4-carboxylic acid (PubChem CID 83862101) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 6,6-dimethyl-1,4,5,7-tetrahydroindazole-4-carboxylic acid.
| Compound Name | 6,6-dimethyl-1,4,5,7-tetrahydroindazole-4-carboxylic acid |
|---|---|
| PubChem CID | 83862101 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 6,6-dimethyl-1,4,5,7-tetrahydroindazole-4-carboxylic acid |
| SMILES | CC1(C)Cc2[nH]ncc2C(C(=O)O)C1 |
| InChI | InChI=1S/C10H14N2O2/c1-10(2)3-6(9(13)14)7-5-11-12-8(7)4-10/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | DUKNMUZLUWLGRF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |