About 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one
4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one (PubChem CID 83862281) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one |
| PubChem CID | 83862281 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one |
| SMILES | CNCc1nc(=O)[nH]c2c1COC2 |
| InChI | InChI=1S/C8H11N3O2/c1-9-2-6-5-3-13-4-7(5)11-8(12)10-6/h9H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | LTCIERTXOAOADL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one?
The IUPAC name of 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one (CID 83862281) is 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one.
What is the SMILES notation for 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one?
The canonical SMILES for 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one is CNCc1nc(=O)[nH]c2c1COC2.
What is the InChIKey of 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one?
The InChIKey is LTCIERTXOAOADL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-9-2-6-5-3-13-4-7(5)11-8(12)10-6/h9H,2-4H2,1H3,(H,10,11,12).
What are the key properties of 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one?
4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one has a molecular weight of 181.19 g/mol, XLogP of -0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylaminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidin-2-one is sourced from PubChem (CID 83862281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).