About N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine
N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine (PubChem CID 83862290) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine |
| PubChem CID | 83862290 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine |
| SMILES | CNc1nc(C(C)C)nc2c1COC2 |
| InChI | InChI=1S/C10H15N3O/c1-6(2)9-12-8-5-14-4-7(8)10(11-3)13-9/h6H,4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | DJXVTXSQALWAMK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine?
The IUPAC name of N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine (CID 83862290) is N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine?
The canonical SMILES for N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine is CNc1nc(C(C)C)nc2c1COC2.
What is the InChIKey of N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine?
The InChIKey is DJXVTXSQALWAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-6(2)9-12-8-5-14-4-7(8)10(11-3)13-9/h6H,4-5H2,1-3H3,(H,11,12,13).
What are the key properties of N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine?
N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine has a molecular weight of 193.25 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-propan-2-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 83862290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).