About N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine
N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine (PubChem CID 83862498) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine |
| PubChem CID | 83862498 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine |
| SMILES | CNCc1c2c(nn1C)CCC2 |
| InChI | InChI=1S/C9H15N3/c1-10-6-9-7-4-3-5-8(7)11-12(9)2/h10H,3-6H2,1-2H3 |
| InChIKey | UKCJRIOSSBWEBX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine?
The IUPAC name of N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine (CID 83862498) is N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine.
What is the SMILES notation for N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine?
The canonical SMILES for N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine is CNCc1c2c(nn1C)CCC2.
What is the InChIKey of N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine?
The InChIKey is UKCJRIOSSBWEBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-10-6-9-7-4-3-5-8(7)11-12(9)2/h10H,3-6H2,1-2H3.
What are the key properties of N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine?
N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine has a molecular weight of 165.24 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methanamine is sourced from PubChem (CID 83862498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).