About 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine
6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine (PubChem CID 83862528) has the molecular formula C13H16N4
and a molecular weight of 228.30 g/mol. Its IUPAC name is 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine |
| PubChem CID | 83862528 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine |
| SMILES | CN1CCc2c(nn(-c3ccccc3)c2N)C1 |
| InChI | InChI=1S/C13H16N4/c1-16-8-7-11-12(9-16)15-17(13(11)14)10-5-3-2-4-6-10/h2-6H,7-9,14H2,1H3 |
| InChIKey | DHYLWULVCDKCRT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine?
The IUPAC name of 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine (CID 83862528) is 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine.
What is the SMILES notation for 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine?
The canonical SMILES for 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine is CN1CCc2c(nn(-c3ccccc3)c2N)C1.
What is the InChIKey of 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine?
The InChIKey is DHYLWULVCDKCRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4/c1-16-8-7-11-12(9-16)15-17(13(11)14)10-5-3-2-4-6-10/h2-6H,7-9,14H2,1H3.
What are the key properties of 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine?
6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine has a molecular weight of 228.30 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-phenyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-3-amine is sourced from PubChem (CID 83862528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).